C17H30O5 — CID 88764212
2-hydroxypropyl 4-ethyl-2-methylideneoctanoate;prop-2-enoic acid (PubChem CID 88764212) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is 2-hydroxypropyl 4-ethyl-2-methylideneoctanoate;prop-2-enoic acid.
| Compound Name | 2-hydroxypropyl 4-ethyl-2-methylideneoctanoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 88764212 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 2-hydroxypropyl 4-ethyl-2-methylideneoctanoate;prop-2-enoic acid |
| SMILES | C=C(CC(CC)CCCC)C(=O)OCC(C)O.C=CC(=O)O |
| InChI | InChI=1S/C14H26O3.C3H4O2/c1-5-7-8-13(6-2)9-11(3)14(16)17-10-12(4)15;1-2-3(4)5/h12-13,15H,3,5-10H2,1-2,4H3;2H,1H2,(H,4,5) |
| InChIKey | WLBZVRQQQFFZOZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|