About N-ethylethanamine;triethoxysilane
N-ethylethanamine;triethoxysilane (PubChem CID 159324808) has the molecular formula C10H27NO3Si
and a molecular weight of 237.42 g/mol. Its IUPAC name is N-ethylethanamine;triethoxysilane.
Molecular Properties
| Compound Name | N-ethylethanamine;triethoxysilane |
| PubChem CID | 159324808 |
| Molecular Formula | C10H27NO3Si |
| Molecular Weight | 237.42 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | N-ethylethanamine;triethoxysilane |
| SMILES | CCNCC.CCO[SiH](OCC)OCC |
| InChI | InChI=1S/C6H16O3Si.C4H11N/c1-4-7-10(8-5-2)9-6-3;1-3-5-4-2/h10H,4-6H2,1-3H3;5H,3-4H2,1-2H3 |
| InChIKey | LEFLVJMAEJSUNI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanamine;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;triethoxysilane?
The IUPAC name of N-ethylethanamine;triethoxysilane (CID 159324808) is N-ethylethanamine;triethoxysilane.
What is the SMILES notation for N-ethylethanamine;triethoxysilane?
The canonical SMILES for N-ethylethanamine;triethoxysilane is CCNCC.CCO[SiH](OCC)OCC.
What is the InChIKey of N-ethylethanamine;triethoxysilane?
The InChIKey is LEFLVJMAEJSUNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C4H11N/c1-4-7-10(8-5-2)9-6-3;1-3-5-4-2/h10H,4-6H2,1-3H3;5H,3-4H2,1-2H3.
What are the key properties of N-ethylethanamine;triethoxysilane?
N-ethylethanamine;triethoxysilane has a molecular weight of 237.42 g/mol, XLogP of 1.43, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;triethoxysilane is sourced from PubChem (CID 159324808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).