About triethoxysilane;zirconium(4+);tetrachloride
triethoxysilane;zirconium(4+);tetrachloride (PubChem CID 175704945) has the molecular formula C6H16Cl4O3SiZr
and a molecular weight of 397.31 g/mol. Its IUPAC name is triethoxysilane;zirconium(4+);tetrachloride.
Molecular Properties
| Compound Name | triethoxysilane;zirconium(4+);tetrachloride |
| PubChem CID | 175704945 |
| Molecular Formula | C6H16Cl4O3SiZr |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 393.87 |
| IUPAC Name | triethoxysilane;zirconium(4+);tetrachloride |
| SMILES | CCO[SiH](OCC)OCC.[Cl-].[Cl-].[Cl-].[Cl-].[Zr+4] |
| InChI | InChI=1S/C6H16O3Si.4ClH.Zr/c1-4-7-10(8-5-2)9-6-3;;;;;/h10H,4-6H2,1-3H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | IACIMYUNOLLQFX-UHFFFAOYSA-J |
| XLogP | -11.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | -11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxysilane;zirconium(4+);tetrachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxysilane;zirconium(4+);tetrachloride?
The IUPAC name of triethoxysilane;zirconium(4+);tetrachloride (CID 175704945) is triethoxysilane;zirconium(4+);tetrachloride.
What is the SMILES notation for triethoxysilane;zirconium(4+);tetrachloride?
The canonical SMILES for triethoxysilane;zirconium(4+);tetrachloride is CCO[SiH](OCC)OCC.[Cl-].[Cl-].[Cl-].[Cl-].[Zr+4].
What is the InChIKey of triethoxysilane;zirconium(4+);tetrachloride?
The InChIKey is IACIMYUNOLLQFX-UHFFFAOYSA-J. The full InChI is InChI=1S/C6H16O3Si.4ClH.Zr/c1-4-7-10(8-5-2)9-6-3;;;;;/h10H,4-6H2,1-3H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of triethoxysilane;zirconium(4+);tetrachloride?
triethoxysilane;zirconium(4+);tetrachloride has a molecular weight of 397.31 g/mol, XLogP of -11.17, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxysilane;zirconium(4+);tetrachloride is sourced from PubChem (CID 175704945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).