About diethoxy(propoxy)silane;dimethoxy(methyl)silane
diethoxy(propoxy)silane;dimethoxy(methyl)silane (PubChem CID 160647833) has the molecular formula C10H28O5Si2
and a molecular weight of 284.50 g/mol. Its IUPAC name is diethoxy(propoxy)silane;dimethoxy(methyl)silane.
Molecular Properties
| Compound Name | diethoxy(propoxy)silane;dimethoxy(methyl)silane |
| PubChem CID | 160647833 |
| Molecular Formula | C10H28O5Si2 |
| Molecular Weight | 284.50 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | diethoxy(propoxy)silane;dimethoxy(methyl)silane |
| SMILES | CCCO[SiH](OCC)OCC.CO[SiH](C)OC |
| InChI | InChI=1S/C7H18O3Si.C3H10O2Si/c1-4-7-10-11(8-5-2)9-6-3;1-4-6(3)5-2/h11H,4-7H2,1-3H3;6H,1-3H3 |
| InChIKey | RKAFILFYUYEQMD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(propoxy)silane;dimethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(propoxy)silane;dimethoxy(methyl)silane?
The IUPAC name of diethoxy(propoxy)silane;dimethoxy(methyl)silane (CID 160647833) is diethoxy(propoxy)silane;dimethoxy(methyl)silane.
What is the SMILES notation for diethoxy(propoxy)silane;dimethoxy(methyl)silane?
The canonical SMILES for diethoxy(propoxy)silane;dimethoxy(methyl)silane is CCCO[SiH](OCC)OCC.CO[SiH](C)OC.
What is the InChIKey of diethoxy(propoxy)silane;dimethoxy(methyl)silane?
The InChIKey is RKAFILFYUYEQMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18O3Si.C3H10O2Si/c1-4-7-10-11(8-5-2)9-6-3;1-4-6(3)5-2/h11H,4-7H2,1-3H3;6H,1-3H3.
What are the key properties of diethoxy(propoxy)silane;dimethoxy(methyl)silane?
diethoxy(propoxy)silane;dimethoxy(methyl)silane has a molecular weight of 284.50 g/mol, XLogP of 1.33, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(propoxy)silane;dimethoxy(methyl)silane is sourced from PubChem (CID 160647833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).