About butoxysilane;dimethoxy(methyl)silane
butoxysilane;dimethoxy(methyl)silane (PubChem CID 158475747) has the molecular formula C7H22O3Si2
and a molecular weight of 210.42 g/mol. Its IUPAC name is butoxysilane;dimethoxy(methyl)silane.
Molecular Properties
| Compound Name | butoxysilane;dimethoxy(methyl)silane |
| PubChem CID | 158475747 |
| Molecular Formula | C7H22O3Si2 |
| Molecular Weight | 210.42 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | butoxysilane;dimethoxy(methyl)silane |
| SMILES | CCCCO[SiH3].CO[SiH](C)OC |
| InChI | InChI=1S/C4H12OSi.C3H10O2Si/c1-2-3-4-5-6;1-4-6(3)5-2/h2-4H2,1,6H3;6H,1-3H3 |
| InChIKey | HGXGWSHZJXBJMB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.42 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butoxysilane;dimethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxysilane;dimethoxy(methyl)silane?
The IUPAC name of butoxysilane;dimethoxy(methyl)silane (CID 158475747) is butoxysilane;dimethoxy(methyl)silane.
What is the SMILES notation for butoxysilane;dimethoxy(methyl)silane?
The canonical SMILES for butoxysilane;dimethoxy(methyl)silane is CCCCO[SiH3].CO[SiH](C)OC.
What is the InChIKey of butoxysilane;dimethoxy(methyl)silane?
The InChIKey is HGXGWSHZJXBJMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi.C3H10O2Si/c1-2-3-4-5-6;1-4-6(3)5-2/h2-4H2,1,6H3;6H,1-3H3.
What are the key properties of butoxysilane;dimethoxy(methyl)silane?
butoxysilane;dimethoxy(methyl)silane has a molecular weight of 210.42 g/mol, XLogP of 0.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butoxysilane;dimethoxy(methyl)silane is sourced from PubChem (CID 158475747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).