About butoxysilane;methyl(silyloxysilyloxy)silane
butoxysilane;methyl(silyloxysilyloxy)silane (PubChem CID 160626778) has the molecular formula C5H22O3Si4
and a molecular weight of 242.57 g/mol. Its IUPAC name is butoxysilane;methyl(silyloxysilyloxy)silane.
Molecular Properties
| Compound Name | butoxysilane;methyl(silyloxysilyloxy)silane |
| PubChem CID | 160626778 |
| Molecular Formula | C5H22O3Si4 |
| Molecular Weight | 242.57 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | butoxysilane;methyl(silyloxysilyloxy)silane |
| SMILES | CCCCO[SiH3].C[SiH2]O[SiH2]O[SiH3] |
| InChI | InChI=1S/C4H12OSi.CH10O2Si3/c1-2-3-4-5-6;1-5-3-6-2-4/h2-4H2,1,6H3;5-6H2,1,4H3 |
| InChIKey | RHKDKRJMGFYZFZ-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.57 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butoxysilane;methyl(silyloxysilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxysilane;methyl(silyloxysilyloxy)silane?
The IUPAC name of butoxysilane;methyl(silyloxysilyloxy)silane (CID 160626778) is butoxysilane;methyl(silyloxysilyloxy)silane.
What is the SMILES notation for butoxysilane;methyl(silyloxysilyloxy)silane?
The canonical SMILES for butoxysilane;methyl(silyloxysilyloxy)silane is CCCCO[SiH3].C[SiH2]O[SiH2]O[SiH3].
What is the InChIKey of butoxysilane;methyl(silyloxysilyloxy)silane?
The InChIKey is RHKDKRJMGFYZFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi.CH10O2Si3/c1-2-3-4-5-6;1-5-3-6-2-4/h2-4H2,1,6H3;5-6H2,1,4H3.
What are the key properties of butoxysilane;methyl(silyloxysilyloxy)silane?
butoxysilane;methyl(silyloxysilyloxy)silane has a molecular weight of 242.57 g/mol, XLogP of -2.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butoxysilane;methyl(silyloxysilyloxy)silane is sourced from PubChem (CID 160626778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).