About propylurea;triethoxysilane
propylurea;triethoxysilane (PubChem CID 161359868) has the molecular formula C10H26N2O4Si
and a molecular weight of 266.41 g/mol. Its IUPAC name is propylurea;triethoxysilane.
Molecular Properties
| Compound Name | propylurea;triethoxysilane |
| PubChem CID | 161359868 |
| Molecular Formula | C10H26N2O4Si |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | propylurea;triethoxysilane |
| SMILES | CCCNC(N)=O.CCO[SiH](OCC)OCC |
| InChI | InChI=1S/C6H16O3Si.C4H10N2O/c1-4-7-10(8-5-2)9-6-3;1-2-3-6-4(5)7/h10H,4-6H2,1-3H3;2-3H2,1H3,(H3,5,6,7) |
| InChIKey | VPANQTKAQTZMSZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze propylurea;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylurea;triethoxysilane?
The IUPAC name of propylurea;triethoxysilane (CID 161359868) is propylurea;triethoxysilane.
What is the SMILES notation for propylurea;triethoxysilane?
The canonical SMILES for propylurea;triethoxysilane is CCCNC(N)=O.CCO[SiH](OCC)OCC.
What is the InChIKey of propylurea;triethoxysilane?
The InChIKey is VPANQTKAQTZMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C4H10N2O/c1-4-7-10(8-5-2)9-6-3;1-2-3-6-4(5)7/h10H,4-6H2,1-3H3;2-3H2,1H3,(H3,5,6,7).
What are the key properties of propylurea;triethoxysilane?
propylurea;triethoxysilane has a molecular weight of 266.41 g/mol, XLogP of 0.88, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propylurea;triethoxysilane is sourced from PubChem (CID 161359868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).