About ethane;prop-1-ene;propylurea
ethane;prop-1-ene;propylurea (PubChem CID 142245891) has the molecular formula C9H22N2O
and a molecular weight of 174.29 g/mol. Its IUPAC name is ethane;prop-1-ene;propylurea.
Molecular Properties
| Compound Name | ethane;prop-1-ene;propylurea |
| PubChem CID | 142245891 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | ethane;prop-1-ene;propylurea |
| SMILES | C=CC.CC.CCCNC(N)=O |
| InChI | InChI=1S/C4H10N2O.C3H6.C2H6/c1-2-3-6-4(5)7;1-3-2;1-2/h2-3H2,1H3,(H3,5,6,7);3H,1H2,2H3;1-2H3 |
| InChIKey | WKGMTGZDSHGJRD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;prop-1-ene;propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;prop-1-ene;propylurea?
The IUPAC name of ethane;prop-1-ene;propylurea (CID 142245891) is ethane;prop-1-ene;propylurea.
What is the SMILES notation for ethane;prop-1-ene;propylurea?
The canonical SMILES for ethane;prop-1-ene;propylurea is C=CC.CC.CCCNC(N)=O.
What is the InChIKey of ethane;prop-1-ene;propylurea?
The InChIKey is WKGMTGZDSHGJRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O.C3H6.C2H6/c1-2-3-6-4(5)7;1-3-2;1-2/h2-3H2,1H3,(H3,5,6,7);3H,1H2,2H3;1-2H3.
What are the key properties of ethane;prop-1-ene;propylurea?
ethane;prop-1-ene;propylurea has a molecular weight of 174.29 g/mol, XLogP of 2.28, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;prop-1-ene;propylurea is sourced from PubChem (CID 142245891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).