C9H16N4O4 — CID 86248796
N'-[2-[[2-oxo-2-(propylamino)acetyl]amino]ethyl]oxamide (PubChem CID 86248796) has the molecular formula C9H16N4O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is N'-[2-[[2-oxo-2-(propylamino)acetyl]amino]ethyl]oxamide.
| Compound Name | N'-[2-[[2-oxo-2-(propylamino)acetyl]amino]ethyl]oxamide |
|---|---|
| PubChem CID | 86248796 |
| Molecular Formula | C9H16N4O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N'-[2-[[2-oxo-2-(propylamino)acetyl]amino]ethyl]oxamide |
| SMILES | CCCNC(=O)C(=O)NCCNC(=O)C(N)=O |
| InChI | InChI=1S/C9H16N4O4/c1-2-3-11-8(16)9(17)13-5-4-12-7(15)6(10)14/h2-5H2,1H3,(H2,10,14)(H,11,16)(H,12,15)(H,13,17) |
| InChIKey | ADYZPSXWJTZORC-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|