C7H14N4O3 — CID 43567602
2-hydrazinyl-2-oxo-N-[2-oxo-2-(propylamino)ethyl]acetamide (PubChem CID 43567602) has the molecular formula C7H14N4O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-hydrazinyl-2-oxo-N-[2-oxo-2-(propylamino)ethyl]acetamide.
| Compound Name | 2-hydrazinyl-2-oxo-N-[2-oxo-2-(propylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 43567602 |
| Molecular Formula | C7H14N4O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-hydrazinyl-2-oxo-N-[2-oxo-2-(propylamino)ethyl]acetamide |
| SMILES | CCCNC(=O)CNC(=O)C(=O)NN |
| InChI | InChI=1S/C7H14N4O3/c1-2-3-9-5(12)4-10-6(13)7(14)11-8/h2-4,8H2,1H3,(H,9,12)(H,10,13)(H,11,14) |
| InChIKey | GQYDAAONNYCLHH-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|