C8H14N2O4 — CID 112616762
methyl 2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]acetate (PubChem CID 112616762) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is methyl 2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]acetate.
| Compound Name | methyl 2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]acetate |
|---|---|
| PubChem CID | 112616762 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | methyl 2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]acetate |
| SMILES | CCCNC(=O)CNC(=O)C(=O)OC |
| InChI | InChI=1S/C8H14N2O4/c1-3-4-9-6(11)5-10-7(12)8(13)14-2/h3-5H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | ZDFJVICGMBFJCU-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|