C38H70N6O10 — CID 158140787
methyl 2-[6-[(2-methoxy-2-oxoacetyl)amino]hexylamino]-2-oxoacetate;N-octyl-N'-[6-[[2-(octylamino)-2-oxoacetyl]amino]hexyl]oxamide (PubChem CID 158140787) has the molecular formula C38H70N6O10 and a molecular weight of 771.01 g/mol. Its IUPAC name is methyl 2-[6-[(2-methoxy-2-oxoacetyl)amino]hexylamino]-2-oxoacetate;N-octyl-N'-[6-[[2-(octylamino)-2-oxoacetyl]amino]hexyl]oxamide.
| Compound Name | methyl 2-[6-[(2-methoxy-2-oxoacetyl)amino]hexylamino]-2-oxoacetate;N-octyl-N'-[6-[[2-(octylamino)-2-oxoacetyl]amino]hexyl]oxamide |
|---|---|
| PubChem CID | 158140787 |
| Molecular Formula | C38H70N6O10 |
| Molecular Weight | 771.01 g/mol |
| Exact Mass | 770.52 |
| IUPAC Name | methyl 2-[6-[(2-methoxy-2-oxoacetyl)amino]hexylamino]-2-oxoacetate;N-octyl-N'-[6-[[2-(octylamino)-2-oxoacetyl]amino]hexyl]oxamide |
| SMILES | CCCCCCCCNC(=O)C(=O)NCCCCCCNC(=O)C(=O)NCCCCCCCC.COC(=O)C(=O)NCCCCCCNC(=O)C(=O)OC |
| InChI | InChI=1S/C26H50N4O4.C12H20N2O6/c1-3-5-7-9-11-15-19-27-23(31)25(33)29-21-17-13-14-18-22-30-26(34)24(32)28-20-16-12-10-8-6-4-2;1-19-11(17)9(15)13-7-5-3-4-6-8-14-10(16)12(18)20-2/h3-22H2,1-2H3,(H,27,31)(H,28,32)(H,29,33)(H,30,34);3-8H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | FTXINOMHDOWZPT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 227.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.01 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|