C10H16N2O6 — CID 118608572
methyl 2-[4-[(2-methoxy-2-oxoacetyl)amino]butylamino]-2-oxoacetate (PubChem CID 118608572) has the molecular formula C10H16N2O6 and a molecular weight of 260.25 g/mol. Its IUPAC name is methyl 2-[4-[(2-methoxy-2-oxoacetyl)amino]butylamino]-2-oxoacetate.
| Compound Name | methyl 2-[4-[(2-methoxy-2-oxoacetyl)amino]butylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 118608572 |
| Molecular Formula | C10H16N2O6 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | methyl 2-[4-[(2-methoxy-2-oxoacetyl)amino]butylamino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NCCCCNC(=O)C(=O)OC |
| InChI | InChI=1S/C10H16N2O6/c1-17-9(15)7(13)11-5-3-4-6-12-8(14)10(16)18-2/h3-6H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | YLVLTVGNOUVFIG-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|