C10H21NO4Si — CID 175715117
methyl 2-[3-[ethoxy(dimethyl)silyl]propylamino]-2-oxoacetate (PubChem CID 175715117) has the molecular formula C10H21NO4Si and a molecular weight of 247.37 g/mol. Its IUPAC name is methyl 2-[3-[ethoxy(dimethyl)silyl]propylamino]-2-oxoacetate.
| Compound Name | methyl 2-[3-[ethoxy(dimethyl)silyl]propylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 175715117 |
| Molecular Formula | C10H21NO4Si |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | methyl 2-[3-[ethoxy(dimethyl)silyl]propylamino]-2-oxoacetate |
| SMILES | CCO[Si](C)(C)CCCNC(=O)C(=O)OC |
| InChI | InChI=1S/C10H21NO4Si/c1-5-15-16(3,4)8-6-7-11-9(12)10(13)14-2/h5-8H2,1-4H3,(H,11,12) |
| InChIKey | XDMVEVTYNFGURS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|