C11H23NO5Si — CID 88852032
(2S)-2-[3-[ethoxy(dimethyl)silyl]propylamino]butanedioic acid (PubChem CID 88852032) has the molecular formula C11H23NO5Si and a molecular weight of 277.39 g/mol. Its IUPAC name is (2S)-2-[3-[ethoxy(dimethyl)silyl]propylamino]butanedioic acid.
| Compound Name | (2S)-2-[3-[ethoxy(dimethyl)silyl]propylamino]butanedioic acid |
|---|---|
| PubChem CID | 88852032 |
| Molecular Formula | C11H23NO5Si |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (2S)-2-[3-[ethoxy(dimethyl)silyl]propylamino]butanedioic acid |
| SMILES | CCO[Si](C)(C)CCCN[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H23NO5Si/c1-4-17-18(2,3)7-5-6-12-9(11(15)16)8-10(13)14/h9,12H,4-8H2,1-3H3,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | LWUOMWMYKDCJTK-VIFPVBQESA-N |
| XLogP | 1.14 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|