C14H30N4Na2O10+2 — CID 134693657
disodium;bis(2-aminoethanol);(2S)-2-[2-[[(1S)-1,2-dicarboxyethyl]amino]ethylamino]butanedioic acid (PubChem CID 134693657) has the molecular formula C14H30N4Na2O10+2 and a molecular weight of 460.39 g/mol. Its IUPAC name is disodium;bis(2-aminoethanol);(2S)-2-[2-[[(1S)-1,2-dicarboxyethyl]amino]ethylamino]butanedioic acid.
| Compound Name | disodium;bis(2-aminoethanol);(2S)-2-[2-[[(1S)-1,2-dicarboxyethyl]amino]ethylamino]butanedioic acid |
|---|---|
| PubChem CID | 134693657 |
| Molecular Formula | C14H30N4Na2O10+2 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | disodium;bis(2-aminoethanol);(2S)-2-[2-[[(1S)-1,2-dicarboxyethyl]amino]ethylamino]butanedioic acid |
| SMILES | NCCO.NCCO.O=C(O)C[C@H](NCCN[C@@H](CC(=O)O)C(=O)O)C(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C10H16N2O8.2C2H7NO.2Na/c13-7(14)3-5(9(17)18)11-1-2-12-6(10(19)20)4-8(15)16;2*3-1-2-4;;/h5-6,11-12H,1-4H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);2*4H,1-3H2;;/q;;;2*+1/t5-,6-;;;;/m0..../s1 |
| InChIKey | KJUPDXXQGDGNMI-UKVIHGRNSA-N |
| XLogP | -10.10 |
| TPSA | 265.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | -10.10 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|