C7H14N2O5 — CID 131850253
(2S)-2-[(3-amino-2-hydroxypropyl)amino]butanedioic acid (PubChem CID 131850253) has the molecular formula C7H14N2O5 and a molecular weight of 206.20 g/mol. Its IUPAC name is (2S)-2-[(3-amino-2-hydroxypropyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[(3-amino-2-hydroxypropyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 131850253 |
| Molecular Formula | C7H14N2O5 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2S)-2-[(3-amino-2-hydroxypropyl)amino]butanedioic acid |
| SMILES | NCC(O)CN[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H14N2O5/c8-2-4(10)3-9-5(7(13)14)1-6(11)12/h4-5,9-10H,1-3,8H2,(H,11,12)(H,13,14)/t4?,5-/m0/s1 |
| InChIKey | HUUWSCGFVMZHCC-AKGZTFGVSA-N |
| XLogP | -2.18 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |