C7H13NO5 — CID 57178792
(2S)-2-[[(2S)-2-hydroxypropyl]amino]butanedioic acid (PubChem CID 57178792) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-hydroxypropyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-hydroxypropyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 57178792 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (2S)-2-[[(2S)-2-hydroxypropyl]amino]butanedioic acid |
| SMILES | C[C@H](O)CN[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H13NO5/c1-4(9)3-8-5(7(12)13)2-6(10)11/h4-5,8-9H,2-3H2,1H3,(H,10,11)(H,12,13)/t4-,5-/m0/s1 |
| InChIKey | HKESPAXYJIPBQI-WHFBIAKZSA-N |
| XLogP | -1.12 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |