C10H16N2O9 — CID 20776652
2-[[2-(1,2-dicarboxyethylamino)-2-hydroxyethyl]amino]butanedioic acid (PubChem CID 20776652) has the molecular formula C10H16N2O9 and a molecular weight of 308.24 g/mol. Its IUPAC name is 2-[[2-(1,2-dicarboxyethylamino)-2-hydroxyethyl]amino]butanedioic acid.
| Compound Name | 2-[[2-(1,2-dicarboxyethylamino)-2-hydroxyethyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 20776652 |
| Molecular Formula | C10H16N2O9 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[[2-(1,2-dicarboxyethylamino)-2-hydroxyethyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(NCC(O)NC(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O9/c13-6(12-5(10(20)21)2-8(16)17)3-11-4(9(18)19)1-7(14)15/h4-6,11-13H,1-3H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | RYBGSPWKZBQCRK-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 193.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|