2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid

C11H18N2O8 — CID 22590659

IUPAC2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid
SMILESCC(CNC(CC(=O)O)C(=O)O)NC(CC(=O)O)C(=O)O
InChIInChI=1S/C11H18N2O8/c1-5(13-7(11(20)21)3-9(16)17)4-12-6(10(18)19)2-8(14)15/h5-7,12-13H,2-4H2,1H3,(H,14,15)(H,16,17)(H,18,19)(H,20,21)
InChIKeyHEHKKKJTGKDBEX-UHFFFAOYSA-N
MW306.27 g/mol
LogP-1.59
Rot. Bonds11

About 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid

2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid (PubChem CID 22590659) has the molecular formula C11H18N2O8 and a molecular weight of 306.27 g/mol. Its IUPAC name is 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid.

Molecular Properties

Compound Name2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid
PubChem CID22590659
Molecular FormulaC11H18N2O8
Molecular Weight306.27 g/mol
Exact Mass306.11
IUPAC Name2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid
SMILESCC(CNC(CC(=O)O)C(=O)O)NC(CC(=O)O)C(=O)O
InChIInChI=1S/C11H18N2O8/c1-5(13-7(11(20)21)3-9(16)17)4-12-6(10(18)19)2-8(14)15/h5-7,12-13H,2-4H2,1H3,(H,14,15)(H,16,17)(H,18,19)(H,20,21)
InChIKeyHEHKKKJTGKDBEX-UHFFFAOYSA-N
XLogP-1.59
TPSA173.26 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds11
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500306.27
LogP ≤ 5-1.59
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Analyze 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid?
The IUPAC name of 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid (CID 22590659) is 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid.
What is the SMILES notation for 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid?
The canonical SMILES for 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid is CC(CNC(CC(=O)O)C(=O)O)NC(CC(=O)O)C(=O)O.
What is the InChIKey of 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid?
The InChIKey is HEHKKKJTGKDBEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O8/c1-5(13-7(11(20)21)3-9(16)17)4-12-6(10(18)19)2-8(14)15/h5-7,12-13H,2-4H2,1H3,(H,14,15)(H,16,17)(H,18,19)(H,20,21).
What are the key properties of 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid?
2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid has a molecular weight of 306.27 g/mol, XLogP of -1.59, 11 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid is sourced from PubChem (CID 22590659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).