C11H18N2O8 — CID 22590659
2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid (PubChem CID 22590659) has the molecular formula C11H18N2O8 and a molecular weight of 306.27 g/mol. Its IUPAC name is 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid.
| Compound Name | 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid |
|---|---|
| PubChem CID | 22590659 |
| Molecular Formula | C11H18N2O8 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-[2-(1,2-dicarboxyethylamino)propylamino]butanedioic acid |
| SMILES | CC(CNC(CC(=O)O)C(=O)O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18N2O8/c1-5(13-7(11(20)21)3-9(16)17)4-12-6(10(18)19)2-8(14)15/h5-7,12-13H,2-4H2,1H3,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | HEHKKKJTGKDBEX-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |