C9H18N2O6 — CID 90177526
3-amino-2-methylpropanoic acid;(2S)-2-(methylamino)butanedioic acid (PubChem CID 90177526) has the molecular formula C9H18N2O6 and a molecular weight of 250.25 g/mol. Its IUPAC name is 3-amino-2-methylpropanoic acid;(2S)-2-(methylamino)butanedioic acid.
| Compound Name | 3-amino-2-methylpropanoic acid;(2S)-2-(methylamino)butanedioic acid |
|---|---|
| PubChem CID | 90177526 |
| Molecular Formula | C9H18N2O6 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3-amino-2-methylpropanoic acid;(2S)-2-(methylamino)butanedioic acid |
| SMILES | CC(CN)C(=O)O.CN[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.C4H9NO2/c1-6-3(5(9)10)2-4(7)8;1-3(2-5)4(6)7/h3,6H,2H2,1H3,(H,7,8)(H,9,10);3H,2,5H2,1H3,(H,6,7)/t3-;/m0./s1 |
| InChIKey | XKEHCESGIZAXEI-DFWYDOINSA-N |
| XLogP | -1.20 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |