(2R)-2-(methylamino)pentanoic acid

C6H13NO2 — CID 15677248

IUPAC(2R)-2-(methylamino)pentanoic acid
SMILESCCC[C@@H](NC)C(=O)O
InChIInChI=1S/C6H13NO2/c1-3-4-5(7-2)6(8)9/h5,7H,3-4H2,1-2H3,(H,8,9)/t5-/m1/s1
InChIKeyHCPKYUNZBPVCHC-RXMQYKEDSA-N
MW131.17 g/mol
LogP0.46
Rot. Bonds4

About (2R)-2-(methylamino)pentanoic acid

(2R)-2-(methylamino)pentanoic acid (PubChem CID 15677248) has the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. Its IUPAC name is (2R)-2-(methylamino)pentanoic acid.

Molecular Properties

Compound Name(2R)-2-(methylamino)pentanoic acid
PubChem CID15677248
Molecular FormulaC6H13NO2
Molecular Weight131.17 g/mol
Exact Mass131.09
IUPAC Name(2R)-2-(methylamino)pentanoic acid
SMILESCCC[C@@H](NC)C(=O)O
InChIInChI=1S/C6H13NO2/c1-3-4-5(7-2)6(8)9/h5,7H,3-4H2,1-2H3,(H,8,9)/t5-/m1/s1
InChIKeyHCPKYUNZBPVCHC-RXMQYKEDSA-N
XLogP0.46
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.17
LogP ≤ 50.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2R)-2-(methylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-2-(methylamino)pentanoic acid;molecular hydrogen;propane
CID 169240700
(2S)-2-(iodoamino)pentanoic acid
CID 175707899
(2S)-N-methyl-2-(methylamino)pentanamide
CID 143782023
butane;2-(hydroxyamino)pentanoic acid
CID 90041467
(2R)-2-(oxidoamino)pentanoic acid
CID 141472977
(2R)-2-[2-(methylamino)propanoylamino]pentanoic acid
CID 107564986
ethane;2-(methylamino)butanoic acid
CID 91558033
6-methyl-2-(methylamino)heptanoic acid
CID 91290146
2-(methylamino)-4-pentoxybutanoic acid
CID 63034607
5-amino-2-(methylamino)hexanoic acid
CID 139342913
(2S)-2-(methylamino)-4-methylsulfanylbutanoic acid
CID 6451891
4-hydroperoxy-2-(methylamino)butanoic acid
CID 59881531

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(methylamino)pentanoic acid?
The IUPAC name of (2R)-2-(methylamino)pentanoic acid (CID 15677248) is (2R)-2-(methylamino)pentanoic acid.
What is the SMILES notation for (2R)-2-(methylamino)pentanoic acid?
The canonical SMILES for (2R)-2-(methylamino)pentanoic acid is CCC[C@@H](NC)C(=O)O.
What is the InChIKey of (2R)-2-(methylamino)pentanoic acid?
The InChIKey is HCPKYUNZBPVCHC-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H13NO2/c1-3-4-5(7-2)6(8)9/h5,7H,3-4H2,1-2H3,(H,8,9)/t5-/m1/s1.
What are the key properties of (2R)-2-(methylamino)pentanoic acid?
(2R)-2-(methylamino)pentanoic acid has a molecular weight of 131.17 g/mol, XLogP of 0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(methylamino)pentanoic acid is sourced from PubChem (CID 15677248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).