C7H11NO7 — CID 86177023
2-[(2-carboxy-2-hydroxyethyl)amino]butanedioic acid (PubChem CID 86177023) has the molecular formula C7H11NO7 and a molecular weight of 221.16 g/mol. Its IUPAC name is 2-[(2-carboxy-2-hydroxyethyl)amino]butanedioic acid.
| Compound Name | 2-[(2-carboxy-2-hydroxyethyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 86177023 |
| Molecular Formula | C7H11NO7 |
| Molecular Weight | 221.16 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 2-[(2-carboxy-2-hydroxyethyl)amino]butanedioic acid |
| SMILES | O=C(O)CC(NCC(O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H11NO7/c9-4(7(14)15)2-8-3(6(12)13)1-5(10)11/h3-4,8-9H,1-2H2,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | GSXSVLOCTWNFIJ-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.16 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |