C8H12N2O7 — CID 132518593
2-[[(1R)-3-amino-1-carboxy-3-oxopropyl]amino]butanedioic acid (PubChem CID 132518593) has the molecular formula C8H12N2O7 and a molecular weight of 248.19 g/mol. Its IUPAC name is 2-[[(1R)-3-amino-1-carboxy-3-oxopropyl]amino]butanedioic acid.
| Compound Name | 2-[[(1R)-3-amino-1-carboxy-3-oxopropyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 132518593 |
| Molecular Formula | C8H12N2O7 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-[[(1R)-3-amino-1-carboxy-3-oxopropyl]amino]butanedioic acid |
| SMILES | NC(=O)C[C@@H](NC(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12N2O7/c9-5(11)1-3(7(14)15)10-4(8(16)17)2-6(12)13/h3-4,10H,1-2H2,(H2,9,11)(H,12,13)(H,14,15)(H,16,17)/t3-,4?/m1/s1 |
| InChIKey | MNVDMRTUVIKLMI-SYPWQXSBSA-N |
| XLogP | -2.17 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |