C4H8N2O5S — CID 59974957
4-amino-4-oxo-2-(sulfinoamino)butanoic acid (PubChem CID 59974957) has the molecular formula C4H8N2O5S and a molecular weight of 196.18 g/mol. Its IUPAC name is 4-amino-4-oxo-2-(sulfinoamino)butanoic acid.
| Compound Name | 4-amino-4-oxo-2-(sulfinoamino)butanoic acid |
|---|---|
| PubChem CID | 59974957 |
| Molecular Formula | C4H8N2O5S |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 4-amino-4-oxo-2-(sulfinoamino)butanoic acid |
| SMILES | NC(=O)CC(NS(=O)O)C(=O)O |
| InChI | InChI=1S/C4H8N2O5S/c5-3(7)1-2(4(8)9)6-12(10)11/h2,6H,1H2,(H2,5,7)(H,8,9)(H,10,11) |
| InChIKey | YGSGXJKVNFSYHK-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|