C6H11ClN2O3 — CID 78061847
4-amino-2-(2-chloroethylamino)-4-oxobutanoic acid (PubChem CID 78061847) has the molecular formula C6H11ClN2O3 and a molecular weight of 194.62 g/mol. Its IUPAC name is 4-amino-2-(2-chloroethylamino)-4-oxobutanoic acid.
| Compound Name | 4-amino-2-(2-chloroethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 78061847 |
| Molecular Formula | C6H11ClN2O3 |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 4-amino-2-(2-chloroethylamino)-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NCCCl)C(=O)O |
| InChI | InChI=1S/C6H11ClN2O3/c7-1-2-9-4(6(11)12)3-5(8)10/h4,9H,1-3H2,(H2,8,10)(H,11,12) |
| InChIKey | OIYCYSCVSMBHNH-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|