C10H20N2O8 — CID 102123543
(2S)-4-amino-4-oxo-2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]butanoic acid (PubChem CID 102123543) has the molecular formula C10H20N2O8 and a molecular weight of 296.28 g/mol. Its IUPAC name is (2S)-4-amino-4-oxo-2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]butanoic acid.
| Compound Name | (2S)-4-amino-4-oxo-2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]butanoic acid |
|---|---|
| PubChem CID | 102123543 |
| Molecular Formula | C10H20N2O8 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (2S)-4-amino-4-oxo-2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]butanoic acid |
| SMILES | NC(=O)C[C@H](NC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C10H20N2O8/c11-7(16)1-4(10(19)20)12-2-5(14)8(17)9(18)6(15)3-13/h4-6,8-9,12-15,17-18H,1-3H2,(H2,11,16)(H,19,20)/t4-,5+,6+,8+,9+/m0/s1 |
| InChIKey | PLEDPSZFNFQPOG-CDNNUPQJSA-N |
| XLogP | -4.66 |
| TPSA | 193.57 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -4.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |