C5H11NO5 — CID 141052833
(2S)-2-(2,2-dihydroxyethylamino)-3-hydroxypropanoic acid (PubChem CID 141052833) has the molecular formula C5H11NO5 and a molecular weight of 165.14 g/mol. Its IUPAC name is (2S)-2-(2,2-dihydroxyethylamino)-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-(2,2-dihydroxyethylamino)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 141052833 |
| Molecular Formula | C5H11NO5 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (2S)-2-(2,2-dihydroxyethylamino)-3-hydroxypropanoic acid |
| SMILES | O=C(O)[C@H](CO)NCC(O)O |
| InChI | InChI=1S/C5H11NO5/c7-2-3(5(10)11)6-1-4(8)9/h3-4,6-9H,1-2H2,(H,10,11)/t3-/m0/s1 |
| InChIKey | OKTVMAYLDJIYQF-VKHMYHEASA-N |
| XLogP | -2.67 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|