C10H19NO8 — CID 54012869
(2S)-2-(2,3,4,5-tetrahydroxypentylamino)pentanedioic acid (PubChem CID 54012869) has the molecular formula C10H19NO8 and a molecular weight of 281.26 g/mol. Its IUPAC name is (2S)-2-(2,3,4,5-tetrahydroxypentylamino)pentanedioic acid.
| Compound Name | (2S)-2-(2,3,4,5-tetrahydroxypentylamino)pentanedioic acid |
|---|---|
| PubChem CID | 54012869 |
| Molecular Formula | C10H19NO8 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (2S)-2-(2,3,4,5-tetrahydroxypentylamino)pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NCC(O)C(O)C(O)CO)C(=O)O |
| InChI | InChI=1S/C10H19NO8/c12-4-7(14)9(17)6(13)3-11-5(10(18)19)1-2-8(15)16/h5-7,9,11-14,17H,1-4H2,(H,15,16)(H,18,19)/t5-,6?,7?,9?/m0/s1 |
| InChIKey | KTPDUZBTLPERAV-AJTLONOZSA-N |
| XLogP | -3.03 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |