C11H21NO9 — CID 21120733
2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentanedioic acid (PubChem CID 21120733) has the molecular formula C11H21NO9 and a molecular weight of 311.29 g/mol. Its IUPAC name is 2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentanedioic acid.
| Compound Name | 2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 21120733 |
| Molecular Formula | C11H21NO9 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C11H21NO9/c13-4-7(15)10(19)9(18)6(14)3-12-5(11(20)21)1-2-8(16)17/h5-7,9-10,12-15,18-19H,1-4H2,(H,16,17)(H,20,21)/t5?,6-,7-,9-,10-/m1/s1 |
| InChIKey | LOSIPCYWORXTAW-PFXJOHDVSA-N |
| XLogP | -3.67 |
| TPSA | 187.78 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |