About 3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid
3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid (PubChem CID 21427717) has the molecular formula C9H19NO8
and a molecular weight of 269.25 g/mol. Its IUPAC name is 3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid.
Analyze 3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid?
The IUPAC name of 3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid (CID 21427717) is 3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid.
What is the SMILES notation for 3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid?
The canonical SMILES for 3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid is O=C(O)C(CO)NCC(O)C(O)C(O)C(O)CO.
What is the InChIKey of 3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid?
The InChIKey is WVQBAOSIBJXODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO8/c11-2-4(9(17)18)10-1-5(13)7(15)8(16)6(14)3-12/h4-8,10-16H,1-3H2,(H,17,18).
What are the key properties of 3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid?
3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid has a molecular weight of 269.25 g/mol, XLogP of -4.54, 9 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-(2,3,4,5,6-pentahydroxyhexylamino)propanoic acid is sourced from PubChem (CID 21427717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).