C11H22N2O8 — CID 102123541
(2S)-5-amino-5-oxo-2-[[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentanoic acid (PubChem CID 102123541) has the molecular formula C11H22N2O8 and a molecular weight of 310.30 g/mol. Its IUPAC name is (2S)-5-amino-5-oxo-2-[[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentanoic acid.
| Compound Name | (2S)-5-amino-5-oxo-2-[[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 102123541 |
| Molecular Formula | C11H22N2O8 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2S)-5-amino-5-oxo-2-[[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentanoic acid |
| SMILES | NC(=O)CC[C@H](NC[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C11H22N2O8/c12-8(17)2-1-5(11(20)21)13-3-6(15)9(18)10(19)7(16)4-14/h5-7,9-10,13-16,18-19H,1-4H2,(H2,12,17)(H,20,21)/t5-,6-,7+,9+,10-/m0/s1 |
| InChIKey | VPRLICVDSGMIKO-ATRYVNFQSA-N |
| XLogP | -4.27 |
| TPSA | 193.57 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |