C11H19N3O7 — CID 123228019
5-amino-2-[(1-carboxy-4-hydroxybutyl)carbamoylamino]-5-oxopentanoic acid (PubChem CID 123228019) has the molecular formula C11H19N3O7 and a molecular weight of 305.29 g/mol. Its IUPAC name is 5-amino-2-[(1-carboxy-4-hydroxybutyl)carbamoylamino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(1-carboxy-4-hydroxybutyl)carbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123228019 |
| Molecular Formula | C11H19N3O7 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-amino-2-[(1-carboxy-4-hydroxybutyl)carbamoylamino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)NC(CCCO)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19N3O7/c12-8(16)4-3-7(10(19)20)14-11(21)13-6(9(17)18)2-1-5-15/h6-7,15H,1-5H2,(H2,12,16)(H,17,18)(H,19,20)(H2,13,14,21) |
| InChIKey | LURGENGFARXTHK-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |