C11H17N3O7 — CID 137398829
5-amino-2-[(1-carboxy-4-oxobutyl)carbamoylamino]-5-oxopentanoic acid (PubChem CID 137398829) has the molecular formula C11H17N3O7 and a molecular weight of 303.27 g/mol. Its IUPAC name is 5-amino-2-[(1-carboxy-4-oxobutyl)carbamoylamino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(1-carboxy-4-oxobutyl)carbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 137398829 |
| Molecular Formula | C11H17N3O7 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-amino-2-[(1-carboxy-4-oxobutyl)carbamoylamino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)NC(CCC=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H17N3O7/c12-8(16)4-3-7(10(19)20)14-11(21)13-6(9(17)18)2-1-5-15/h5-7H,1-4H2,(H2,12,16)(H,17,18)(H,19,20)(H2,13,14,21) |
| InChIKey | UTBFVPLQEVZKGI-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 175.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|