C9H14ClN3O4 — CID 107831097
(2R)-5-amino-2-(2-chloroprop-2-enylcarbamoylamino)-5-oxopentanoic acid (PubChem CID 107831097) has the molecular formula C9H14ClN3O4 and a molecular weight of 263.68 g/mol. Its IUPAC name is (2R)-5-amino-2-(2-chloroprop-2-enylcarbamoylamino)-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-(2-chloroprop-2-enylcarbamoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107831097 |
| Molecular Formula | C9H14ClN3O4 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | (2R)-5-amino-2-(2-chloroprop-2-enylcarbamoylamino)-5-oxopentanoic acid |
| SMILES | C=C(Cl)CNC(=O)N[C@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H14ClN3O4/c1-5(10)4-12-9(17)13-6(8(15)16)2-3-7(11)14/h6H,1-4H2,(H2,11,14)(H,15,16)(H2,12,13,17)/t6-/m1/s1 |
| InChIKey | PFMMDARXGNPFPI-ZCFIWIBFSA-N |
| XLogP | -0.24 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |