C11H18N4O5 — CID 61201562
(2S)-5-amino-2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-5-oxopentanoic acid (PubChem CID 61201562) has the molecular formula C11H18N4O5 and a molecular weight of 286.29 g/mol. Its IUPAC name is (2S)-5-amino-2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 61201562 |
| Molecular Formula | C11H18N4O5 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (2S)-5-amino-2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)NCC(=O)NC1CC1)C(=O)O |
| InChI | InChI=1S/C11H18N4O5/c12-8(16)4-3-7(10(18)19)15-11(20)13-5-9(17)14-6-1-2-6/h6-7H,1-5H2,(H2,12,16)(H,14,17)(H,18,19)(H2,13,15,20)/t7-/m0/s1 |
| InChIKey | ZRYQAYOIHBFCIK-ZETCQYMHSA-N |
| XLogP | -1.72 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |