C4H10NO6P — CID 25153772
(2S)-3-hydroxy-2-(phosphonomethylamino)propanoic acid (PubChem CID 25153772) has the molecular formula C4H10NO6P and a molecular weight of 199.10 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-(phosphonomethylamino)propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-(phosphonomethylamino)propanoic acid |
|---|---|
| PubChem CID | 25153772 |
| Molecular Formula | C4H10NO6P |
| Molecular Weight | 199.10 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | (2S)-3-hydroxy-2-(phosphonomethylamino)propanoic acid |
| SMILES | O=C(O)[C@H](CO)NCP(=O)(O)O |
| InChI | InChI=1S/C4H10NO6P/c6-1-3(4(7)8)5-2-12(9,10)11/h3,5-6H,1-2H2,(H,7,8)(H2,9,10,11)/t3-/m0/s1 |
| InChIKey | RRWROSIFPFQOBK-VKHMYHEASA-N |
| XLogP | -1.84 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.10 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|