C4H12NO9PS2 — CID 87618119
2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid (PubChem CID 87618119) has the molecular formula C4H12NO9PS2 and a molecular weight of 313.25 g/mol. Its IUPAC name is 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid.
| Compound Name | 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid |
|---|---|
| PubChem CID | 87618119 |
| Molecular Formula | C4H12NO9PS2 |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid |
| SMILES | O=C(O)C(CS)NCP(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C4H10NO5PS.H2O4S/c6-4(7)3(1-12)5-2-11(8,9)10;1-5(2,3)4/h3,5,12H,1-2H2,(H,6,7)(H2,8,9,10);(H2,1,2,3,4) |
| InChIKey | ZXWQQIOJRRPCBS-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|