2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid

C4H12NO9PS2 — CID 87618119

IUPAC2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid
SMILESO=C(O)C(CS)NCP(=O)(O)O.O=S(=O)(O)O
InChIInChI=1S/C4H10NO5PS.H2O4S/c6-4(7)3(1-12)5-2-11(8,9)10;1-5(2,3)4/h3,5,12H,1-2H2,(H,6,7)(H2,8,9,10);(H2,1,2,3,4)
InChIKeyZXWQQIOJRRPCBS-UHFFFAOYSA-N
MW313.25 g/mol
LogP-1.56
Rot. Bonds5

About 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid

2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid (PubChem CID 87618119) has the molecular formula C4H12NO9PS2 and a molecular weight of 313.25 g/mol. Its IUPAC name is 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid.

Molecular Properties

Compound Name2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid
PubChem CID87618119
Molecular FormulaC4H12NO9PS2
Molecular Weight313.25 g/mol
Exact Mass312.97
IUPAC Name2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid
SMILESO=C(O)C(CS)NCP(=O)(O)O.O=S(=O)(O)O
InChIInChI=1S/C4H10NO5PS.H2O4S/c6-4(7)3(1-12)5-2-11(8,9)10;1-5(2,3)4/h3,5,12H,1-2H2,(H,6,7)(H2,8,9,10);(H2,1,2,3,4)
InChIKeyZXWQQIOJRRPCBS-UHFFFAOYSA-N
XLogP-1.56
TPSA181.46 Ų
H-Bond Donors7
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500313.25
LogP ≤ 5-1.56
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid?
The IUPAC name of 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid (CID 87618119) is 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid.
What is the SMILES notation for 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid?
The canonical SMILES for 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid is O=C(O)C(CS)NCP(=O)(O)O.O=S(=O)(O)O.
What is the InChIKey of 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid?
The InChIKey is ZXWQQIOJRRPCBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10NO5PS.H2O4S/c6-4(7)3(1-12)5-2-11(8,9)10;1-5(2,3)4/h3,5,12H,1-2H2,(H,6,7)(H2,8,9,10);(H2,1,2,3,4).
What are the key properties of 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid?
2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid has a molecular weight of 313.25 g/mol, XLogP of -1.56, 5 rotatable bonds, 7 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(phosphonomethylamino)-3-sulfanylpropanoic acid;sulfuric acid is sourced from PubChem (CID 87618119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).