C6H11NO2S — CID 87666603
(2S)-2-(prop-2-enylamino)-3-sulfanylpropanoic acid (PubChem CID 87666603) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is (2S)-2-(prop-2-enylamino)-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-(prop-2-enylamino)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87666603 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | (2S)-2-(prop-2-enylamino)-3-sulfanylpropanoic acid |
| SMILES | C=CCN[C@H](CS)C(=O)O |
| InChI | InChI=1S/C6H11NO2S/c1-2-3-7-5(4-10)6(8)9/h2,5,7,10H,1,3-4H2,(H,8,9)/t5-/m1/s1 |
| InChIKey | AMPHKYRLSOPVBX-RXMQYKEDSA-N |
| XLogP | 0.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|