6-amino-2-(prop-2-enylamino)hexanoic acid

C9H18N2O2 — CID 87168024

IUPAC6-amino-2-(prop-2-enylamino)hexanoic acid
SMILESC=CCNC(CCCCN)C(=O)O
InChIInChI=1S/C9H18N2O2/c1-2-7-11-8(9(12)13)5-3-4-6-10/h2,8,11H,1,3-7,10H2,(H,12,13)
InChIKeyMVUVVORWXMDPJN-UHFFFAOYSA-N
MW186.25 g/mol
LogP0.34
Rot. Bonds8

About 6-amino-2-(prop-2-enylamino)hexanoic acid

6-amino-2-(prop-2-enylamino)hexanoic acid (PubChem CID 87168024) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 6-amino-2-(prop-2-enylamino)hexanoic acid.

Molecular Properties

Compound Name6-amino-2-(prop-2-enylamino)hexanoic acid
PubChem CID87168024
Molecular FormulaC9H18N2O2
Molecular Weight186.25 g/mol
Exact Mass186.14
IUPAC Name6-amino-2-(prop-2-enylamino)hexanoic acid
SMILESC=CCNC(CCCCN)C(=O)O
InChIInChI=1S/C9H18N2O2/c1-2-7-11-8(9(12)13)5-3-4-6-10/h2,8,11H,1,3-7,10H2,(H,12,13)
InChIKeyMVUVVORWXMDPJN-UHFFFAOYSA-N
XLogP0.34
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.25
LogP ≤ 50.34
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 6-amino-2-(prop-2-enylamino)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

6-amino-2-(hydroxymethylamino)hexanoic acid
CID 18519143
6-amino-2-(carboxymethylamino)hexanoic acid
CID 11680034
6-amino-2-(ethylamino)hexanoic acid;dihydrochloride
CID 175594704
6-amino-2-(2-phosphonobut-3-enylamino)hexanoic acid
CID 87479009
acetic acid;(2S)-6-amino-2-(ethylamino)hexanoic acid
CID 162326558
(2S)-6-amino-2-(phosphonomethylamino)hexanoic acid
CID 25153976
(2S)-6-amino-2-(3,3-dihydroxypropylamino)hexanoic acid
CID 87855201
(2R)-6-amino-2-(hydroxyamino)hexanoic acid
CID 87193141
(2S)-5-amino-2-(ethenylamino)pentanoic acid
CID 172797723
(2S)-2-(prop-2-enylamino)-3-sulfanylpropanoic acid
CID 87666603
(2R)-5-amino-2-(carboxymethylamino)pentanoic acid
CID 22810355
5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride
CID 174056033

Frequently Asked Questions

What is the IUPAC name of 6-amino-2-(prop-2-enylamino)hexanoic acid?
The IUPAC name of 6-amino-2-(prop-2-enylamino)hexanoic acid (CID 87168024) is 6-amino-2-(prop-2-enylamino)hexanoic acid.
What is the SMILES notation for 6-amino-2-(prop-2-enylamino)hexanoic acid?
The canonical SMILES for 6-amino-2-(prop-2-enylamino)hexanoic acid is C=CCNC(CCCCN)C(=O)O.
What is the InChIKey of 6-amino-2-(prop-2-enylamino)hexanoic acid?
The InChIKey is MVUVVORWXMDPJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-2-7-11-8(9(12)13)5-3-4-6-10/h2,8,11H,1,3-7,10H2,(H,12,13).
What are the key properties of 6-amino-2-(prop-2-enylamino)hexanoic acid?
6-amino-2-(prop-2-enylamino)hexanoic acid has a molecular weight of 186.25 g/mol, XLogP of 0.34, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-(prop-2-enylamino)hexanoic acid is sourced from PubChem (CID 87168024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).