C7H17N2O5P — CID 25153976
(2S)-6-amino-2-(phosphonomethylamino)hexanoic acid (PubChem CID 25153976) has the molecular formula C7H17N2O5P and a molecular weight of 240.20 g/mol. Its IUPAC name is (2S)-6-amino-2-(phosphonomethylamino)hexanoic acid.
| Compound Name | (2S)-6-amino-2-(phosphonomethylamino)hexanoic acid |
|---|---|
| PubChem CID | 25153976 |
| Molecular Formula | C7H17N2O5P |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (2S)-6-amino-2-(phosphonomethylamino)hexanoic acid |
| SMILES | NCCCC[C@H](NCP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C7H17N2O5P/c8-4-2-1-3-6(7(10)11)9-5-15(12,13)14/h6,9H,1-5,8H2,(H,10,11)(H2,12,13,14)/t6-/m0/s1 |
| InChIKey | VARALOVKQGZNMI-LURJTMIESA-N |
| XLogP | -0.71 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|