C8H18N3O6P — CID 25153969
(2S)-6-(carbamoylamino)-2-(phosphonomethylamino)hexanoic acid (PubChem CID 25153969) has the molecular formula C8H18N3O6P and a molecular weight of 283.22 g/mol. Its IUPAC name is (2S)-6-(carbamoylamino)-2-(phosphonomethylamino)hexanoic acid.
| Compound Name | (2S)-6-(carbamoylamino)-2-(phosphonomethylamino)hexanoic acid |
|---|---|
| PubChem CID | 25153969 |
| Molecular Formula | C8H18N3O6P |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (2S)-6-(carbamoylamino)-2-(phosphonomethylamino)hexanoic acid |
| SMILES | NC(=O)NCCCC[C@H](NCP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C8H18N3O6P/c9-8(14)10-4-2-1-3-6(7(12)13)11-5-18(15,16)17/h6,11H,1-5H2,(H,12,13)(H3,9,10,14)(H2,15,16,17)/t6-/m0/s1 |
| InChIKey | XCXHVTFIBCHXMF-LURJTMIESA-N |
| XLogP | -1.00 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|