C14H27N3O6 — CID 123252946
8-[[4-(carbamoylamino)-1-carboxybutyl]amino]-8-hydroxyoctanoic acid (PubChem CID 123252946) has the molecular formula C14H27N3O6 and a molecular weight of 333.39 g/mol. Its IUPAC name is 8-[[4-(carbamoylamino)-1-carboxybutyl]amino]-8-hydroxyoctanoic acid.
| Compound Name | 8-[[4-(carbamoylamino)-1-carboxybutyl]amino]-8-hydroxyoctanoic acid |
|---|---|
| PubChem CID | 123252946 |
| Molecular Formula | C14H27N3O6 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 8-[[4-(carbamoylamino)-1-carboxybutyl]amino]-8-hydroxyoctanoic acid |
| SMILES | NC(=O)NCCCC(NC(O)CCCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H27N3O6/c15-14(23)16-9-5-6-10(13(21)22)17-11(18)7-3-1-2-4-8-12(19)20/h10-11,17-18H,1-9H2,(H,19,20)(H,21,22)(H3,15,16,23) |
| InChIKey | PKPUYMMBPYDSGL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|