C16H29N5O7 — CID 175784350
(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]pentanedioic acid (PubChem CID 175784350) has the molecular formula C16H29N5O7 and a molecular weight of 403.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 175784350 |
| Molecular Formula | C16H29N5O7 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]pentanedioic acid |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](CCCNC(N)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H29N5O7/c1-8(2)12(17)14(25)20-9(4-3-7-19-16(18)28)13(24)21-10(15(26)27)5-6-11(22)23/h8-10,12H,3-7,17H2,1-2H3,(H,20,25)(H,21,24)(H,22,23)(H,26,27)(H3,18,19,28)/t9-,10-,12-/m0/s1 |
| InChIKey | HNXICTKPMINYAG-NHCYSSNCSA-N |
| XLogP | -1.66 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|