C14H27N5O5 — CID 170745517
[[2-[(2-amino-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]methyl acetate (PubChem CID 170745517) has the molecular formula C14H27N5O5 and a molecular weight of 345.40 g/mol. Its IUPAC name is [[2-[(2-amino-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]methyl acetate.
| Compound Name | [[2-[(2-amino-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]methyl acetate |
|---|---|
| PubChem CID | 170745517 |
| Molecular Formula | C14H27N5O5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | [[2-[(2-amino-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]methyl acetate |
| SMILES | CC(=O)OCNC(=O)C(CCCNC(N)=O)NC(=O)C(N)C(C)C |
| InChI | InChI=1S/C14H27N5O5/c1-8(2)11(15)13(22)19-10(5-4-6-17-14(16)23)12(21)18-7-24-9(3)20/h8,10-11H,4-7,15H2,1-3H3,(H,18,21)(H,19,22)(H3,16,17,23) |
| InChIKey | CZDKBVLZBWCFOZ-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|