C18H29N5O4 — CID 70143672
(2S)-2-amino-N-[(3S)-1-(4-aminophenyl)-6-(carbamoylamino)-1-hydroxy-2-oxohexan-3-yl]-3-methylbutanamide (PubChem CID 70143672) has the molecular formula C18H29N5O4 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3S)-1-(4-aminophenyl)-6-(carbamoylamino)-1-hydroxy-2-oxohexan-3-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[(3S)-1-(4-aminophenyl)-6-(carbamoylamino)-1-hydroxy-2-oxohexan-3-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 70143672 |
| Molecular Formula | C18H29N5O4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | (2S)-2-amino-N-[(3S)-1-(4-aminophenyl)-6-(carbamoylamino)-1-hydroxy-2-oxohexan-3-yl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](CCCNC(N)=O)C(=O)C(O)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H29N5O4/c1-10(2)14(20)17(26)23-13(4-3-9-22-18(21)27)16(25)15(24)11-5-7-12(19)8-6-11/h5-8,10,13-15,24H,3-4,9,19-20H2,1-2H3,(H,23,26)(H3,21,22,27)/t13-,14-,15?/m0/s1 |
| InChIKey | IIFQHXBDNBTFIS-ZYOSVBKOSA-N |
| XLogP | -0.21 |
| TPSA | 173.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|