C18H29N5O7S — CID 167525362
5-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-(hydroxymethyl)benzenesulfonic acid (PubChem CID 167525362) has the molecular formula C18H29N5O7S and a molecular weight of 459.53 g/mol. Its IUPAC name is 5-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-(hydroxymethyl)benzenesulfonic acid.
| Compound Name | 5-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-(hydroxymethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 167525362 |
| Molecular Formula | C18H29N5O7S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 5-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]-2-(hydroxymethyl)benzenesulfonic acid |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CO)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H29N5O7S/c1-10(2)15(19)17(26)23-13(4-3-7-21-18(20)27)16(25)22-12-6-5-11(9-24)14(8-12)31(28,29)30/h5-6,8,10,13,15,24H,3-4,7,9,19H2,1-2H3,(H,22,25)(H,23,26)(H3,20,21,27)(H,28,29,30)/t13-,15-/m0/s1 |
| InChIKey | YFRZGMYPXDMXPI-ZFWWWQNUSA-N |
| XLogP | -0.72 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|