C30H43N5O6 — CID 175699066
tert-butyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[3-(2-ethynylpent-4-ynyl)-4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 175699066) has the molecular formula C30H43N5O6 and a molecular weight of 569.70 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[3-(2-ethynylpent-4-ynyl)-4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[3-(2-ethynylpent-4-ynyl)-4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 175699066 |
| Molecular Formula | C30H43N5O6 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.32 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[3-(2-ethynylpent-4-ynyl)-4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#CCC(C#C)Cc1cc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)ccc1CO |
| InChI | InChI=1S/C30H43N5O6/c1-8-11-20(9-2)16-22-17-23(14-13-21(22)18-36)33-26(37)24(12-10-15-32-28(31)39)34-27(38)25(19(3)4)35-29(40)41-30(5,6)7/h1-2,13-14,17,19-20,24-25,36H,10-12,15-16,18H2,3-7H3,(H,33,37)(H,34,38)(H,35,40)(H3,31,32,39)/t20?,24-,25-/m0/s1 |
| InChIKey | STUSJSPSMUTQFR-PTOFZMKOSA-N |
| XLogP | 2.42 |
| TPSA | 171.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|