C26H41N5O7 — CID 90805918
(4-propylphenyl)carbamoyl 5-(carbamoylamino)-2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pentanoate (PubChem CID 90805918) has the molecular formula C26H41N5O7 and a molecular weight of 535.64 g/mol. Its IUPAC name is (4-propylphenyl)carbamoyl 5-(carbamoylamino)-2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pentanoate.
| Compound Name | (4-propylphenyl)carbamoyl 5-(carbamoylamino)-2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 90805918 |
| Molecular Formula | C26H41N5O7 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | (4-propylphenyl)carbamoyl 5-(carbamoylamino)-2-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pentanoate |
| SMILES | CCCc1ccc(NC(=O)OC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)OC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C26H41N5O7/c1-7-9-17-11-13-18(14-12-17)29-24(35)37-22(33)19(10-8-15-28-23(27)34)30-21(32)20(16(2)3)31-25(36)38-26(4,5)6/h11-14,16,19-20H,7-10,15H2,1-6H3,(H,29,35)(H,30,32)(H,31,36)(H3,27,28,34) |
| InChIKey | MGOMTRYSOSJISQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|