C23H36N6O6 — CID 126713811
[4-[[2-[(2-acetamido-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl N-ethylcarbamate (PubChem CID 126713811) has the molecular formula C23H36N6O6 and a molecular weight of 492.58 g/mol. Its IUPAC name is [4-[[2-[(2-acetamido-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl N-ethylcarbamate.
| Compound Name | [4-[[2-[(2-acetamido-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 126713811 |
| Molecular Formula | C23H36N6O6 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | [4-[[2-[(2-acetamido-3-methylbutanoyl)amino]-5-(carbamoylamino)pentanoyl]amino]phenyl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCc1ccc(NC(=O)C(CCCNC(N)=O)NC(=O)C(NC(C)=O)C(C)C)cc1 |
| InChI | InChI=1S/C23H36N6O6/c1-5-25-23(34)35-13-16-8-10-17(11-9-16)28-20(31)18(7-6-12-26-22(24)33)29-21(32)19(14(2)3)27-15(4)30/h8-11,14,18-19H,5-7,12-13H2,1-4H3,(H,25,34)(H,27,30)(H,28,31)(H,29,32)(H3,24,26,33) |
| InChIKey | RNSJDIIFBAQMKR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 180.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|